3-AMINOIMIDAZO(1,2-A)PYRIDINE
Catalog No: FT-0656209
CAS No: 28036-33-1
- Chemical Name: 3-AMINOIMIDAZO(1,2-A)PYRIDINE
- Molecular Formula: C7H7N3
- Molecular Weight: 133.15
- InChI Key: RTOFMMILZZGGNS-UHFFFAOYSA-N
- InChI: InChI=1S/C7H7N3/c8-6-5-9-7-3-1-2-4-10(6)7/h1-5H,8H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 133.151 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 28036-33-1 |
| Bolling_Point: | N/A |
| Product_Name: | Imidazo[1,2-a]pyridin-3-amine |
| Melting_Point: | 114-126ºC |
| Flash_Point: | N/A |
| MF: | C7H7N3 |
| Melting_Point: | 114-126ºC |
|---|---|
| Density: | 1.3±0.1 g/cm3 |
| LogP: | 0.76 |
| Refractive_Index: | 1.697 |
| FW: | 133.151 |
| PSA: | 43.32000 |
| MF: | C7H7N3 |
| Exact_Mass: | 133.063995 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R22 |
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)